C6H5NO2S — CID 64993709
(E)-3-hydroxy-1-(1,3-thiazol-2-yl)prop-2-en-1-one (PubChem CID 64993709) has the molecular formula C6H5NO2S and a molecular weight of 155.18 g/mol. Its IUPAC name is (E)-3-hydroxy-1-(1,3-thiazol-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-hydroxy-1-(1,3-thiazol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 64993709 |
| Molecular Formula | C6H5NO2S |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.00 |
| IUPAC Name | (E)-3-hydroxy-1-(1,3-thiazol-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/O)c1nccs1 |
| InChI | InChI=1S/C6H5NO2S/c8-3-1-5(9)6-7-2-4-10-6/h1-4,8H/b3-1+ |
| InChIKey | FOCCELPTNFEBEY-HNQUOIGGSA-N |
| XLogP | 1.40 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|