C23H18NOPS — CID 11728794
1-(1,3-thiazol-2-yl)-2-(triphenyl-λ5-phosphanylidene)ethanone (PubChem CID 11728794) has the molecular formula C23H18NOPS and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)-2-(triphenyl-λ5-phosphanylidene)ethanone.
| Compound Name | 1-(1,3-thiazol-2-yl)-2-(triphenyl-λ5-phosphanylidene)ethanone |
|---|---|
| PubChem CID | 11728794 |
| Molecular Formula | C23H18NOPS |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)-2-(triphenyl-λ5-phosphanylidene)ethanone |
| SMILES | O=C(C=P(c1ccccc1)(c1ccccc1)c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C23H18NOPS/c25-22(23-24-16-17-27-23)18-26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H |
| InChIKey | BDLILDUGSQLIBT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|