C10H8N2O2S — CID 110467924
N-(2-hydroxyphenyl)-1,3-thiazole-2-carboxamide (PubChem CID 110467924) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 110467924 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | N-(2-hydroxyphenyl)-1,3-thiazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1O)c1nccs1 |
| InChI | InChI=1S/C10H8N2O2S/c13-8-4-2-1-3-7(8)12-9(14)10-11-5-6-15-10/h1-6,13H,(H,12,14) |
| InChIKey | FESHHSVOFAPCLB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|