C12H10N2O2S — CID 110696027
N-(4-acetylphenyl)-1,3-thiazole-2-carboxamide (PubChem CID 110696027) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is N-(4-acetylphenyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-(4-acetylphenyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 110696027 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | N-(4-acetylphenyl)-1,3-thiazole-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2nccs2)cc1 |
| InChI | InChI=1S/C12H10N2O2S/c1-8(15)9-2-4-10(5-3-9)14-11(16)12-13-6-7-17-12/h2-7H,1H3,(H,14,16) |
| InChIKey | AMGCZDAXPXJUJM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |