C9H8N2OS2 — CID 146277087
N-(5-methylthiophen-2-yl)-1,3-thiazole-2-carboxamide (PubChem CID 146277087) has the molecular formula C9H8N2OS2 and a molecular weight of 224.31 g/mol. Its IUPAC name is N-(5-methylthiophen-2-yl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-(5-methylthiophen-2-yl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 146277087 |
| Molecular Formula | C9H8N2OS2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | N-(5-methylthiophen-2-yl)-1,3-thiazole-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2nccs2)s1 |
| InChI | InChI=1S/C9H8N2OS2/c1-6-2-3-7(14-6)11-8(12)9-10-4-5-13-9/h2-5H,1H3,(H,11,12) |
| InChIKey | VIDTZUWJYXDLGJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |