C12H10N4OS — CID 110467967
N-(1-methylindazol-6-yl)-1,3-thiazole-2-carboxamide (PubChem CID 110467967) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is N-(1-methylindazol-6-yl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-(1-methylindazol-6-yl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 110467967 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(1-methylindazol-6-yl)-1,3-thiazole-2-carboxamide |
| SMILES | Cn1ncc2ccc(NC(=O)c3nccs3)cc21 |
| InChI | InChI=1S/C12H10N4OS/c1-16-10-6-9(3-2-8(10)7-14-16)15-11(17)12-13-4-5-18-12/h2-7H,1H3,(H,15,17) |
| InChIKey | DRYYHYANXNNRBQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |