C13H12N2O2S — CID 24702385
N-(4-acetylphenyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 24702385) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-acetylphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24702385 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | N-(4-acetylphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2scnc2C)cc1 |
| InChI | InChI=1S/C13H12N2O2S/c1-8-12(18-7-14-8)13(17)15-11-5-3-10(4-6-11)9(2)16/h3-7H,1-2H3,(H,15,17) |
| InChIKey | HWDDCEXDCGDFNT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |