C12H10FN3OS2 — CID 55057585
N-(3-carbamothioyl-4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 55057585) has the molecular formula C12H10FN3OS2 and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(3-carbamothioyl-4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(3-carbamothioyl-4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55057585 |
| Molecular Formula | C12H10FN3OS2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | N-(3-carbamothioyl-4-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)Nc1ccc(F)c(C(N)=S)c1 |
| InChI | InChI=1S/C12H10FN3OS2/c1-6-10(19-5-15-6)12(17)16-7-2-3-9(13)8(4-7)11(14)18/h2-5H,1H3,(H2,14,18)(H,16,17) |
| InChIKey | IRKWUEUTHQRCAE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|