C14H12N2O3S — CID 43654539
(E)-3-[4-[(4-methyl-1,3-thiazole-5-carbonyl)amino]phenyl]prop-2-enoic acid (PubChem CID 43654539) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is (E)-3-[4-[(4-methyl-1,3-thiazole-5-carbonyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(4-methyl-1,3-thiazole-5-carbonyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 43654539 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (E)-3-[4-[(4-methyl-1,3-thiazole-5-carbonyl)amino]phenyl]prop-2-enoic acid |
| SMILES | Cc1ncsc1C(=O)Nc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C14H12N2O3S/c1-9-13(20-8-15-9)14(19)16-11-5-2-10(3-6-11)4-7-12(17)18/h2-8H,1H3,(H,16,19)(H,17,18)/b7-4+ |
| InChIKey | USGBFHKJFFTRFB-QPJJXVBHSA-N |
| XLogP | 2.80 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|