C15H17N3OS — CID 47035824
4-methyl-N-(4-pyrrolidin-1-ylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 47035824) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 4-methyl-N-(4-pyrrolidin-1-ylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-(4-pyrrolidin-1-ylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 47035824 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-methyl-N-(4-pyrrolidin-1-ylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C15H17N3OS/c1-11-14(20-10-16-11)15(19)17-12-4-6-13(7-5-12)18-8-2-3-9-18/h4-7,10H,2-3,8-9H2,1H3,(H,17,19) |
| InChIKey | CVYNUHJSUPCJBV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|