C28H26N6O2S — CID 67113731
4-methyl-N-[4-[5-(4-morpholin-4-ylanilino)indazol-1-yl]phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 67113731) has the molecular formula C28H26N6O2S and a molecular weight of 510.62 g/mol. Its IUPAC name is 4-methyl-N-[4-[5-(4-morpholin-4-ylanilino)indazol-1-yl]phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[4-[5-(4-morpholin-4-ylanilino)indazol-1-yl]phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 67113731 |
| Molecular Formula | C28H26N6O2S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 4-methyl-N-[4-[5-(4-morpholin-4-ylanilino)indazol-1-yl]phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)Nc1ccc(-n2ncc3cc(Nc4ccc(N5CCOCC5)cc4)ccc32)cc1 |
| InChI | InChI=1S/C28H26N6O2S/c1-19-27(37-18-29-19)28(35)32-22-4-9-25(10-5-22)34-26-11-6-23(16-20(26)17-30-34)31-21-2-7-24(8-3-21)33-12-14-36-15-13-33/h2-11,16-18,31H,12-15H2,1H3,(H,32,35) |
| InChIKey | OJXWQODJSLZOJH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|