C23H25N3O2S — CID 7594221
2-(4-ethylphenyl)-4-methyl-N-(4-morpholin-4-ylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 7594221) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-4-methyl-N-(4-morpholin-4-ylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-ethylphenyl)-4-methyl-N-(4-morpholin-4-ylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 7594221 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-(4-ethylphenyl)-4-methyl-N-(4-morpholin-4-ylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCc1ccc(-c2nc(C)c(C(=O)Nc3ccc(N4CCOCC4)cc3)s2)cc1 |
| InChI | InChI=1S/C23H25N3O2S/c1-3-17-4-6-18(7-5-17)23-24-16(2)21(29-23)22(27)25-19-8-10-20(11-9-19)26-12-14-28-15-13-26/h4-11H,3,12-15H2,1-2H3,(H,25,27) |
| InChIKey | DKZMAFOHKOLLFA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|