C24H28N4OS — CID 46430563
2-benzyl-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 46430563) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is 2-benzyl-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-benzyl-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46430563 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-benzyl-N-[4-(4-ethylpiperazin-1-yl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3sc(Cc4ccccc4)nc3C)cc2)CC1 |
| InChI | InChI=1S/C24H28N4OS/c1-3-27-13-15-28(16-14-27)21-11-9-20(10-12-21)26-24(29)23-18(2)25-22(30-23)17-19-7-5-4-6-8-19/h4-12H,3,13-17H2,1-2H3,(H,26,29) |
| InChIKey | QRKQOAIEILHKPE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|