C22H30N4OS — CID 110387166
4-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]-2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-5-carboxamide (PubChem CID 110387166) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is 4-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]-2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]-2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110387166 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]-2-(pyrrolidin-1-ylmethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(CN2CCCC2)sc1C(=O)Nc1ccc(N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C22H30N4OS/c1-16-9-13-26(14-10-16)19-7-5-18(6-8-19)24-22(27)21-17(2)23-20(28-21)15-25-11-3-4-12-25/h5-8,16H,3-4,9-15H2,1-2H3,(H,24,27) |
| InChIKey | RLUQFMUOYHJQSS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|