C20H27N3OS — CID 56556375
2-butyl-4-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 56556375) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is 2-butyl-4-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-butyl-4-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 56556375 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-butyl-4-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCCCc1nc(C)c(C(=O)Nc2ccc(N3CCC(C)C3)cc2)s1 |
| InChI | InChI=1S/C20H27N3OS/c1-4-5-6-18-21-15(3)19(25-18)20(24)22-16-7-9-17(10-8-16)23-12-11-14(2)13-23/h7-10,14H,4-6,11-13H2,1-3H3,(H,22,24) |
| InChIKey | KEDLRZAPJKYMTM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|