C16H15NO4 — CID 86782516
(E)-3-[4-[(4,5-dimethylfuran-2-carbonyl)amino]phenyl]prop-2-enoic acid (PubChem CID 86782516) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is (E)-3-[4-[(4,5-dimethylfuran-2-carbonyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(4,5-dimethylfuran-2-carbonyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 86782516 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (E)-3-[4-[(4,5-dimethylfuran-2-carbonyl)amino]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C(=O)Nc2ccc(/C=C/C(=O)O)cc2)oc1C |
| InChI | InChI=1S/C16H15NO4/c1-10-9-14(21-11(10)2)16(20)17-13-6-3-12(4-7-13)5-8-15(18)19/h3-9H,1-2H3,(H,17,20)(H,18,19)/b8-5+ |
| InChIKey | HUPFTGNSTWOFMA-VMPITWQZSA-N |
| XLogP | 3.25 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|