C19H19NO6 — CID 21486337
(E)-3-[4-[(3,4,5-trimethoxybenzoyl)amino]phenyl]prop-2-enoic acid (PubChem CID 21486337) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is (E)-3-[4-[(3,4,5-trimethoxybenzoyl)amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(3,4,5-trimethoxybenzoyl)amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 21486337 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (E)-3-[4-[(3,4,5-trimethoxybenzoyl)amino]phenyl]prop-2-enoic acid |
| SMILES | COc1cc(C(=O)Nc2ccc(/C=C/C(=O)O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19NO6/c1-24-15-10-13(11-16(25-2)18(15)26-3)19(23)20-14-7-4-12(5-8-14)6-9-17(21)22/h4-11H,1-3H3,(H,20,23)(H,21,22)/b9-6+ |
| InChIKey | DJOCZQHCRSQOPR-RMKNXTFCSA-N |
| XLogP | 3.06 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|