C26H28N2O8 — CID 4578304
3,4,5-trimethoxy-N-[3-[(3,4,5-trimethoxybenzoyl)amino]phenyl]benzamide (PubChem CID 4578304) has the molecular formula C26H28N2O8 and a molecular weight of 496.52 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-[(3,4,5-trimethoxybenzoyl)amino]phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[3-[(3,4,5-trimethoxybenzoyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 4578304 |
| Molecular Formula | C26H28N2O8 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-[(3,4,5-trimethoxybenzoyl)amino]phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2cccc(NC(=O)c3cc(OC)c(OC)c(OC)c3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C26H28N2O8/c1-31-19-10-15(11-20(32-2)23(19)35-5)25(29)27-17-8-7-9-18(14-17)28-26(30)16-12-21(33-3)24(36-6)22(13-16)34-4/h7-14H,1-6H3,(H,27,29)(H,28,30) |
| InChIKey | BKRWTXFJEFCZMF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |