C25H25N3O6 — CID 126229364
3-methyl-N-[3-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 126229364) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is 3-methyl-N-[3-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | 3-methyl-N-[3-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 126229364 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 3-methyl-N-[3-[[(3,4,5-trimethoxybenzoyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cccc(NC(=O)c3cccc(C)c3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H25N3O6/c1-15-7-5-8-16(11-15)23(29)26-19-10-6-9-17(12-19)24(30)27-28-25(31)18-13-20(32-2)22(34-4)21(14-18)33-3/h5-14H,1-4H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | FHWOVUCUURIMOX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|