C17H17IN2O5 — CID 2715629
N'-(3-iodobenzoyl)-3,4,5-trimethoxybenzohydrazide (PubChem CID 2715629) has the molecular formula C17H17IN2O5 and a molecular weight of 456.24 g/mol. Its IUPAC name is N'-(3-iodobenzoyl)-3,4,5-trimethoxybenzohydrazide.
| Compound Name | N'-(3-iodobenzoyl)-3,4,5-trimethoxybenzohydrazide |
|---|---|
| PubChem CID | 2715629 |
| Molecular Formula | C17H17IN2O5 |
| Molecular Weight | 456.24 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | N'-(3-iodobenzoyl)-3,4,5-trimethoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cccc(I)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17IN2O5/c1-23-13-8-11(9-14(24-2)15(13)25-3)17(22)20-19-16(21)10-5-4-6-12(18)7-10/h4-9H,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | RUPATTUMQFTLSQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|