C24H23N3O6 — CID 126008715
N-[2-(benzamidocarbamoyl)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 126008715) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is N-[2-(benzamidocarbamoyl)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(benzamidocarbamoyl)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 126008715 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[2-(benzamidocarbamoyl)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2C(=O)NNC(=O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23N3O6/c1-31-19-13-16(14-20(32-2)21(19)33-3)22(28)25-18-12-8-7-11-17(18)24(30)27-26-23(29)15-9-5-4-6-10-15/h4-14H,1-3H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | MEOPTWVJDKNXCD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|