C22H21N3O7 — CID 126008403
N-[2-[(furan-2-carbonylamino)carbamoyl]phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 126008403) has the molecular formula C22H21N3O7 and a molecular weight of 439.42 g/mol. Its IUPAC name is N-[2-[(furan-2-carbonylamino)carbamoyl]phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[(furan-2-carbonylamino)carbamoyl]phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 126008403 |
| Molecular Formula | C22H21N3O7 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-[2-[(furan-2-carbonylamino)carbamoyl]phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2C(=O)NNC(=O)c2ccco2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N3O7/c1-29-17-11-13(12-18(30-2)19(17)31-3)20(26)23-15-8-5-4-7-14(15)21(27)24-25-22(28)16-9-6-10-32-16/h4-12H,1-3H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | KMGDIZOFTQRPKI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|