C23H23N3O5 — CID 2803194
3,4,5-trimethoxy-N-[2-(pyridin-3-ylmethylcarbamoyl)phenyl]benzamide (PubChem CID 2803194) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-(pyridin-3-ylmethylcarbamoyl)phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-(pyridin-3-ylmethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2803194 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-(pyridin-3-ylmethylcarbamoyl)phenyl]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2C(=O)NCc2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H23N3O5/c1-29-19-11-16(12-20(30-2)21(19)31-3)22(27)26-18-9-5-4-8-17(18)23(28)25-14-15-7-6-10-24-13-15/h4-13H,14H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | WZPAZZBZOTVLOC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |