C23H24N2O5 — CID 55708070
3,4,5-trimethoxy-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]benzamide (PubChem CID 55708070) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55708070 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[4-(pyridin-3-ylmethoxy)phenyl]methyl]benzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(OCc3cccnc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N2O5/c1-27-20-11-18(12-21(28-2)22(20)29-3)23(26)25-14-16-6-8-19(9-7-16)30-15-17-5-4-10-24-13-17/h4-13H,14-15H2,1-3H3,(H,25,26) |
| InChIKey | JZNFRJNMOMDXQP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |