C24H24N2O6 — CID 990875
3,4,5-trimethoxy-N-[2-[(2-methoxyphenyl)carbamoyl]phenyl]benzamide (PubChem CID 990875) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-[(2-methoxyphenyl)carbamoyl]phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-[(2-methoxyphenyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 990875 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-[(2-methoxyphenyl)carbamoyl]phenyl]benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccccc1NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H24N2O6/c1-29-19-12-8-7-11-18(19)26-24(28)16-9-5-6-10-17(16)25-23(27)15-13-20(30-2)22(32-4)21(14-15)31-3/h5-14H,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | RCCQLDRURFMGGI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |