C27H32N2O5 — CID 2923053
N-[2-(1-adamantylcarbamoyl)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 2923053) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is N-[2-(1-adamantylcarbamoyl)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(1-adamantylcarbamoyl)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2923053 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | N-[2-(1-adamantylcarbamoyl)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2C(=O)NC23CC4CC(CC(C4)C2)C3)cc(OC)c1OC |
| InChI | InChI=1S/C27H32N2O5/c1-32-22-11-19(12-23(33-2)24(22)34-3)25(30)28-21-7-5-4-6-20(21)26(31)29-27-13-16-8-17(14-27)10-18(9-16)15-27/h4-7,11-12,16-18H,8-10,13-15H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | ISKJQTPMAUOJOZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |