C23H28N2O6 — CID 42944718
N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 42944718) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 42944718 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2C(=O)N2CC(C)OC(C)C2)cc(OC)c1OC |
| InChI | InChI=1S/C23H28N2O6/c1-14-12-25(13-15(2)31-14)23(27)17-8-6-7-9-18(17)24-22(26)16-10-19(28-3)21(30-5)20(11-16)29-4/h6-11,14-15H,12-13H2,1-5H3,(H,24,26) |
| InChIKey | ZFTNUQCDINWECX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |