C21H23N3O6 — CID 42893742
N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-4-methoxy-3-nitrobenzamide (PubChem CID 42893742) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 42893742 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(=O)N2CC(C)OC(C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23N3O6/c1-13-11-23(12-14(2)30-13)21(26)16-6-4-5-7-17(16)22-20(25)15-8-9-19(29-3)18(10-15)24(27)28/h4-10,13-14H,11-12H2,1-3H3,(H,22,25) |
| InChIKey | BVHSWMRFSBLTNN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|