C18H22N4O5S — CID 42933449
N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-4-methoxy-3-nitrobenzamide (PubChem CID 42933449) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 42933449 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)Nc2nc(CN3CC(C)OC(C)C3)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N4O5S/c1-11-7-21(8-12(2)27-11)9-14-10-28-18(19-14)20-17(23)13-4-5-16(26-3)15(6-13)22(24)25/h4-6,10-12H,7-9H2,1-3H3,(H,19,20,23) |
| InChIKey | CCFAAYZFRVMMDS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|