C16H20N4O4S2 — CID 55575594
N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-5-methyl-4-nitrothiophene-2-carboxamide (PubChem CID 55575594) has the molecular formula C16H20N4O4S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-5-methyl-4-nitrothiophene-2-carboxamide.
| Compound Name | N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-5-methyl-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55575594 |
| Molecular Formula | C16H20N4O4S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-5-methyl-4-nitrothiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)Nc2nc(CN3CC(C)OC(C)C3)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N4O4S2/c1-9-5-19(6-10(2)24-9)7-12-8-25-16(17-12)18-15(21)14-4-13(20(22)23)11(3)26-14/h4,8-10H,5-7H2,1-3H3,(H,17,18,21) |
| InChIKey | ROKCUPAPFUFXHU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|