C22H24N6O5S — CID 55507209
N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide (PubChem CID 55507209) has the molecular formula C22H24N6O5S and a molecular weight of 484.54 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide.
| Compound Name | N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55507209 |
| Molecular Formula | C22H24N6O5S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2nc(CN3CC(C)OC(C)C3)cs2)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24N6O5S/c1-13-8-19(29)20(25-27(13)17-6-4-5-7-18(17)28(31)32)21(30)24-22-23-16(12-34-22)11-26-9-14(2)33-15(3)10-26/h4-8,12,14-15H,9-11H2,1-3H3,(H,23,24,30) |
| InChIKey | GWHKRMKJVSEMTJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|