C17H16N6O4S — CID 27447504
6-methyl-1-(2-nitrophenyl)-4-oxo-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)pyridazine-3-carboxamide (PubChem CID 27447504) has the molecular formula C17H16N6O4S and a molecular weight of 400.42 g/mol. Its IUPAC name is 6-methyl-1-(2-nitrophenyl)-4-oxo-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)pyridazine-3-carboxamide.
| Compound Name | 6-methyl-1-(2-nitrophenyl)-4-oxo-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 27447504 |
| Molecular Formula | C17H16N6O4S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 6-methyl-1-(2-nitrophenyl)-4-oxo-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2nnc(C(C)C)s2)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N6O4S/c1-9(2)16-19-20-17(28-16)18-15(25)14-13(24)8-10(3)22(21-14)11-6-4-5-7-12(11)23(26)27/h4-9H,1-3H3,(H,18,20,25) |
| InChIKey | GFGRUNWTDABNCW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|