C20H16Cl2N4O4 — CID 55372886
N-[1-(3,4-dichlorophenyl)ethyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide (PubChem CID 55372886) has the molecular formula C20H16Cl2N4O4 and a molecular weight of 447.28 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55372886 |
| Molecular Formula | C20H16Cl2N4O4 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NC(C)c2ccc(Cl)c(Cl)c2)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16Cl2N4O4/c1-11-9-18(27)19(24-25(11)16-5-3-4-6-17(16)26(29)30)20(28)23-12(2)13-7-8-14(21)15(22)10-13/h3-10,12H,1-2H3,(H,23,28) |
| InChIKey | GZGJHBHZPKCDAT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|