C21H18Cl2N4O4 — CID 55581423
N-[1-(2,4-dichlorophenyl)ethyl]-N,6-dimethyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide (PubChem CID 55581423) has the molecular formula C21H18Cl2N4O4 and a molecular weight of 461.31 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-N,6-dimethyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-N,6-dimethyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55581423 |
| Molecular Formula | C21H18Cl2N4O4 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-N,6-dimethyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)N(C)C(C)c2ccc(Cl)cc2Cl)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H18Cl2N4O4/c1-12-10-19(28)20(24-26(12)17-6-4-5-7-18(17)27(30)31)21(29)25(3)13(2)15-9-8-14(22)11-16(15)23/h4-11,13H,1-3H3 |
| InChIKey | IKZYZQNVXNEYBQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|