C24H24N6O4 — CID 112798364
N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide (PubChem CID 112798364) has the molecular formula C24H24N6O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 112798364 |
| Molecular Formula | C24H24N6O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-3-methylbutyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NC(CC(C)C)c2nc3ccccc3[nH]2)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H24N6O4/c1-14(2)12-18(23-25-16-8-4-5-9-17(16)26-23)27-24(32)22-21(31)13-15(3)29(28-22)19-10-6-7-11-20(19)30(33)34/h4-11,13-14,18H,12H2,1-3H3,(H,25,26)(H,27,32) |
| InChIKey | VRMJJALJQPUDIL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|