C23H17FN4O4S — CID 55389502
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide (PubChem CID 55389502) has the molecular formula C23H17FN4O4S and a molecular weight of 464.48 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55389502 |
| Molecular Formula | C23H17FN4O4S |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NC(c2ccc(F)cc2)c2cccs2)nn1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H17FN4O4S/c1-14-13-19(29)22(26-27(14)17-5-2-3-6-18(17)28(31)32)23(30)25-21(20-7-4-12-33-20)15-8-10-16(24)11-9-15/h2-13,21H,1H3,(H,25,30) |
| InChIKey | JSLUMYNGTPSNPS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|