C18H14FN3O3S — CID 41263224
4-amino-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-3-nitrobenzamide (PubChem CID 41263224) has the molecular formula C18H14FN3O3S and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-amino-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-3-nitrobenzamide.
| Compound Name | 4-amino-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 41263224 |
| Molecular Formula | C18H14FN3O3S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 4-amino-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]-3-nitrobenzamide |
| SMILES | Nc1ccc(C(=O)N[C@H](c2ccc(F)cc2)c2cccs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14FN3O3S/c19-13-6-3-11(4-7-13)17(16-2-1-9-26-16)21-18(23)12-5-8-14(20)15(10-12)22(24)25/h1-10,17H,20H2,(H,21,23)/t17-/m1/s1 |
| InChIKey | QFJMNVQELCTPTG-QGZVFWFLSA-N |
| XLogP | 3.90 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|