C18H16FN5O3 — CID 26076514
4-amino-N-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-nitrobenzamide (PubChem CID 26076514) has the molecular formula C18H16FN5O3 and a molecular weight of 369.36 g/mol. Its IUPAC name is 4-amino-N-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-nitrobenzamide.
| Compound Name | 4-amino-N-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 26076514 |
| Molecular Formula | C18H16FN5O3 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-amino-N-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-nitrobenzamide |
| SMILES | Cn1ccnc1[C@@H](NC(=O)c1ccc(N)c([N+](=O)[O-])c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FN5O3/c1-23-9-8-21-17(23)16(11-2-5-13(19)6-3-11)22-18(25)12-4-7-14(20)15(10-12)24(26)27/h2-10,16H,20H2,1H3,(H,22,25)/t16-/m0/s1 |
| InChIKey | WKMMALFAOUUPON-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|