C21H20FN5O4 — CID 25388894
N-[2-[[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitrobenzamide (PubChem CID 25388894) has the molecular formula C21H20FN5O4 and a molecular weight of 425.42 g/mol. Its IUPAC name is N-[2-[[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 25388894 |
| Molecular Formula | C21H20FN5O4 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[2-[[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)N[C@@H](c2ccc(F)cc2)c2nccn2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20FN5O4/c1-13-3-4-15(11-17(13)27(30)31)21(29)24-12-18(28)25-19(20-23-9-10-26(20)2)14-5-7-16(22)8-6-14/h3-11,19H,12H2,1-2H3,(H,24,29)(H,25,28)/t19-/m0/s1 |
| InChIKey | POJFCPCQEVPUBT-IBGZPJMESA-N |
| XLogP | 2.41 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|