C15H18FN3O2 — CID 110429258
N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-methoxypropanamide (PubChem CID 110429258) has the molecular formula C15H18FN3O2 and a molecular weight of 291.33 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-methoxypropanamide.
| Compound Name | N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 110429258 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-methoxypropanamide |
| SMILES | COCCC(=O)NC(c1ccc(F)cc1)c1nccn1C |
| InChI | InChI=1S/C15H18FN3O2/c1-19-9-8-17-15(19)14(18-13(20)7-10-21-2)11-3-5-12(16)6-4-11/h3-6,8-9,14H,7,10H2,1-2H3,(H,18,20) |
| InChIKey | JXUTZOLHQOASBV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |