C21H21F2N3O — CID 55925130
3-(4-fluorophenyl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]butanamide (PubChem CID 55925130) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]butanamide.
| Compound Name | 3-(4-fluorophenyl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 55925130 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]butanamide |
| SMILES | CC(CC(=O)NC(c1ccc(F)cc1)c1nccn1C)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21F2N3O/c1-14(15-3-7-17(22)8-4-15)13-19(27)25-20(21-24-11-12-26(21)2)16-5-9-18(23)10-6-16/h3-12,14,20H,13H2,1-2H3,(H,25,27) |
| InChIKey | RIQCPBPCXAOCOI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |