C16H21FN4O2 — CID 94055737
1-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(3-methoxypropyl)urea (PubChem CID 94055737) has the molecular formula C16H21FN4O2 and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(3-methoxypropyl)urea.
| Compound Name | 1-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 94055737 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-[(S)-(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(3-methoxypropyl)urea |
| SMILES | COCCCNC(=O)N[C@@H](c1ccc(F)cc1)c1nccn1C |
| InChI | InChI=1S/C16H21FN4O2/c1-21-10-9-18-15(21)14(12-4-6-13(17)7-5-12)20-16(22)19-8-3-11-23-2/h4-7,9-10,14H,3,8,11H2,1-2H3,(H2,19,20,22)/t14-/m0/s1 |
| InChIKey | KGAGZFWVXPEEOP-AWEZNQCLSA-N |
| XLogP | 1.98 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|