C16H21ClN4O — CID 36961553
1-butyl-3-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]urea (PubChem CID 36961553) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 1-butyl-3-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]urea.
| Compound Name | 1-butyl-3-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 36961553 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-butyl-3-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]urea |
| SMILES | CCCCNC(=O)N[C@@H](c1ccc(Cl)cc1)c1nccn1C |
| InChI | InChI=1S/C16H21ClN4O/c1-3-4-9-19-16(22)20-14(15-18-10-11-21(15)2)12-5-7-13(17)8-6-12/h5-8,10-11,14H,3-4,9H2,1-2H3,(H2,19,20,22)/t14-/m0/s1 |
| InChIKey | CTVCKBJFMQOJFA-AWEZNQCLSA-N |
| XLogP | 3.26 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|