C16H21ClN4O2 — CID 94042521
1-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(2-ethoxyethyl)urea (PubChem CID 94042521) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is 1-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(2-ethoxyethyl)urea.
| Compound Name | 1-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(2-ethoxyethyl)urea |
|---|---|
| PubChem CID | 94042521 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(2-ethoxyethyl)urea |
| SMILES | CCOCCNC(=O)N[C@@H](c1ccc(Cl)cc1)c1nccn1C |
| InChI | InChI=1S/C16H21ClN4O2/c1-3-23-11-9-19-16(22)20-14(15-18-8-10-21(15)2)12-4-6-13(17)7-5-12/h4-8,10,14H,3,9,11H2,1-2H3,(H2,19,20,22)/t14-/m0/s1 |
| InChIKey | KZPDEHDIJULDHL-AWEZNQCLSA-N |
| XLogP | 2.50 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|