C22H24ClN3O3 — CID 27034467
N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3,4-diethoxybenzamide (PubChem CID 27034467) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3,4-diethoxybenzamide.
| Compound Name | N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 27034467 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N[C@@H](c2ccc(Cl)cc2)c2nccn2C)cc1OCC |
| InChI | InChI=1S/C22H24ClN3O3/c1-4-28-18-11-8-16(14-19(18)29-5-2)22(27)25-20(21-24-12-13-26(21)3)15-6-9-17(23)10-7-15/h6-14,20H,4-5H2,1-3H3,(H,25,27)/t20-/m0/s1 |
| InChIKey | QATPUBSXGUQZEG-FQEVSTJZSA-N |
| XLogP | 4.39 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |