C24H20ClN3O — CID 27034422
N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-4-phenylbenzamide (PubChem CID 27034422) has the molecular formula C24H20ClN3O and a molecular weight of 401.90 g/mol. Its IUPAC name is N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-4-phenylbenzamide.
| Compound Name | N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 27034422 |
| Molecular Formula | C24H20ClN3O |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-4-phenylbenzamide |
| SMILES | Cn1ccnc1[C@H](NC(=O)c1ccc(-c2ccccc2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20ClN3O/c1-28-16-15-26-23(28)22(19-11-13-21(25)14-12-19)27-24(29)20-9-7-18(8-10-20)17-5-3-2-4-6-17/h2-16,22H,1H3,(H,27,29)/t22-/m1/s1 |
| InChIKey | DBHZWDOCKIXROU-JOCHJYFZSA-N |
| XLogP | 5.26 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |