C16H21ClN4O2 — CID 95129972
1-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[(2R)-1-methoxypropan-2-yl]urea (PubChem CID 95129972) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is 1-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[(2R)-1-methoxypropan-2-yl]urea.
| Compound Name | 1-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[(2R)-1-methoxypropan-2-yl]urea |
|---|---|
| PubChem CID | 95129972 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[(2R)-1-methoxypropan-2-yl]urea |
| SMILES | COC[C@@H](C)NC(=O)N[C@H](c1ccc(Cl)cc1)c1nccn1C |
| InChI | InChI=1S/C16H21ClN4O2/c1-11(10-23-3)19-16(22)20-14(15-18-8-9-21(15)2)12-4-6-13(17)7-5-12/h4-9,11,14H,10H2,1-3H3,(H2,19,20,22)/t11-,14-/m1/s1 |
| InChIKey | ILZMZSUMJCEQKQ-BXUZGUMPSA-N |
| XLogP | 2.50 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |