C14H18Cl2N4O — CID 119273847
(2R)-2-amino-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide;hydrochloride (PubChem CID 119273847) has the molecular formula C14H18Cl2N4O and a molecular weight of 329.23 g/mol. Its IUPAC name is (2R)-2-amino-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide;hydrochloride.
| Compound Name | (2R)-2-amino-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119273847 |
| Molecular Formula | C14H18Cl2N4O |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (2R)-2-amino-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide;hydrochloride |
| SMILES | C[C@@H](N)C(=O)NC(c1ccc(Cl)cc1)c1nccn1C.Cl |
| InChI | InChI=1S/C14H17ClN4O.ClH/c1-9(16)14(20)18-12(13-17-7-8-19(13)2)10-3-5-11(15)6-4-10;/h3-9,12H,16H2,1-2H3,(H,18,20);1H/t9-,12?;/m1./s1 |
| InChIKey | CRWOGSLSAOULRM-SWHRJYHISA-N |
| XLogP | 2.05 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |