C16H13Cl2N3OS — CID 25344825
5-chloro-N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]thiophene-2-carboxamide (PubChem CID 25344825) has the molecular formula C16H13Cl2N3OS and a molecular weight of 366.27 g/mol. Its IUPAC name is 5-chloro-N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 25344825 |
| Molecular Formula | C16H13Cl2N3OS |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 5-chloro-N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]thiophene-2-carboxamide |
| SMILES | Cn1ccnc1[C@@H](NC(=O)c1ccc(Cl)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13Cl2N3OS/c1-21-9-8-19-15(21)14(10-2-4-11(17)5-3-10)20-16(22)12-6-7-13(18)23-12/h2-9,14H,1H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | OXHJMQZKBGKXJQ-AWEZNQCLSA-N |
| XLogP | 4.31 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |