C21H23ClN4O3 — CID 36506060
1-[2-(4-chlorophenoxy)ethyl]-3-[(R)-(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea (PubChem CID 36506060) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-[(R)-(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[(R)-(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 36506060 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[(R)-(3-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]urea |
| SMILES | COc1cccc([C@@H](NC(=O)NCCOc2ccc(Cl)cc2)c2nccn2C)c1 |
| InChI | InChI=1S/C21H23ClN4O3/c1-26-12-10-23-20(26)19(15-4-3-5-18(14-15)28-2)25-21(27)24-11-13-29-17-8-6-16(22)7-9-17/h3-10,12,14,19H,11,13H2,1-2H3,(H2,24,25,27)/t19-/m1/s1 |
| InChIKey | GAISXBBIGZYJHR-LJQANCHMSA-N |
| XLogP | 3.55 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|